C12H17NO3 — CID 65064280
3-ethyl-1-(furan-3-ylmethyl)pyrrolidine-3-carboxylic acid (PubChem CID 65064280) has the molecular formula C12H17NO3 and a molecular weight of 223.27 g/mol. Its IUPAC name is 3-ethyl-1-(furan-3-ylmethyl)pyrrolidine-3-carboxylic acid.
| Compound Name | 3-ethyl-1-(furan-3-ylmethyl)pyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 65064280 |
| Molecular Formula | C12H17NO3 |
| Molecular Weight | 223.27 g/mol |
| Exact Mass | 223.12 |
| IUPAC Name | 3-ethyl-1-(furan-3-ylmethyl)pyrrolidine-3-carboxylic acid |
| SMILES | CCC1(C(=O)O)CCN(Cc2ccoc2)C1 |
| InChI | InChI=1S/C12H17NO3/c1-2-12(11(14)15)4-5-13(9-12)7-10-3-6-16-8-10/h3,6,8H,2,4-5,7,9H2,1H3,(H,14,15) |
| InChIKey | OFBNDXGESSFSNR-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 53.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.27 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |