2-[2,3-dihydro-1H-inden-2-yl(propyl)amino]acetic acid

C14H19NO2 — CID 65065076

IUPAC2-[2,3-dihydro-1H-inden-2-yl(propyl)amino]acetic acid
SMILESCCCN(CC(=O)O)C1Cc2ccccc2C1
InChIInChI=1S/C14H19NO2/c1-2-7-15(10-14(16)17)13-8-11-5-3-4-6-12(11)9-13/h3-6,13H,2,7-10H2,1H3,(H,16,17)
InChIKeyRDNHFLJICDWITN-UHFFFAOYSA-N
MW233.31 g/mol
LogP1.95
Rot. Bonds5

About 2-[2,3-dihydro-1H-inden-2-yl(propyl)amino]acetic acid

2-[2,3-dihydro-1H-inden-2-yl(propyl)amino]acetic acid (PubChem CID 65065076) has the molecular formula C14H19NO2 and a molecular weight of 233.31 g/mol. Its IUPAC name is 2-[2,3-dihydro-1H-inden-2-yl(propyl)amino]acetic acid.

Molecular Properties

Compound Name2-[2,3-dihydro-1H-inden-2-yl(propyl)amino]acetic acid
PubChem CID65065076
Molecular FormulaC14H19NO2
Molecular Weight233.31 g/mol
Exact Mass233.14
IUPAC Name2-[2,3-dihydro-1H-inden-2-yl(propyl)amino]acetic acid
SMILESCCCN(CC(=O)O)C1Cc2ccccc2C1
InChIInChI=1S/C14H19NO2/c1-2-7-15(10-14(16)17)13-8-11-5-3-4-6-12(11)9-13/h3-6,13H,2,7-10H2,1H3,(H,16,17)
InChIKeyRDNHFLJICDWITN-UHFFFAOYSA-N
XLogP1.95
TPSA40.54 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds5
Heavy Atoms17
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500233.31
LogP ≤ 51.95
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 2-[2,3-dihydro-1H-inden-2-yl(propyl)amino]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[2,3-dihydro-1H-inden-2-yl(propyl)amino]acetic acid?
The IUPAC name of 2-[2,3-dihydro-1H-inden-2-yl(propyl)amino]acetic acid (CID 65065076) is 2-[2,3-dihydro-1H-inden-2-yl(propyl)amino]acetic acid.
What is the SMILES notation for 2-[2,3-dihydro-1H-inden-2-yl(propyl)amino]acetic acid?
The canonical SMILES for 2-[2,3-dihydro-1H-inden-2-yl(propyl)amino]acetic acid is CCCN(CC(=O)O)C1Cc2ccccc2C1.
What is the InChIKey of 2-[2,3-dihydro-1H-inden-2-yl(propyl)amino]acetic acid?
The InChIKey is RDNHFLJICDWITN-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19NO2/c1-2-7-15(10-14(16)17)13-8-11-5-3-4-6-12(11)9-13/h3-6,13H,2,7-10H2,1H3,(H,16,17).
What are the key properties of 2-[2,3-dihydro-1H-inden-2-yl(propyl)amino]acetic acid?
2-[2,3-dihydro-1H-inden-2-yl(propyl)amino]acetic acid has a molecular weight of 233.31 g/mol, XLogP of 1.95, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2,3-dihydro-1H-inden-2-yl(propyl)amino]acetic acid is sourced from PubChem (CID 65065076), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).