About (17Z)-17-methoxyimino-15,16-dihydrocyclopenta[a]phenanthrene-3,4-dione
(17Z)-17-methoxyimino-15,16-dihydrocyclopenta[a]phenanthrene-3,4-dione (PubChem CID 6506538) has the molecular formula C18H13NO3
and a molecular weight of 291.31 g/mol. Its IUPAC name is (17Z)-17-methoxyimino-15,16-dihydrocyclopenta[a]phenanthrene-3,4-dione.
Molecular Properties
| Compound Name | (17Z)-17-methoxyimino-15,16-dihydrocyclopenta[a]phenanthrene-3,4-dione |
| PubChem CID | 6506538 |
| Molecular Formula | C18H13NO3 |
| Molecular Weight | 291.31 g/mol |
| Exact Mass | 291.09 |
| IUPAC Name | (17Z)-17-methoxyimino-15,16-dihydrocyclopenta[a]phenanthrene-3,4-dione |
| SMILES | CO/N=C1/CCc2c1ccc1c3c(ccc21)C(=O)C(=O)C=C3 |
| InChI | InChI=1S/C18H13NO3/c1-22-19-16-8-6-12-10-3-5-15-13(7-9-17(20)18(15)21)11(10)2-4-14(12)16/h2-5,7,9H,6,8H2,1H3/b19-16- |
| InChIKey | ZTRJELYBPMBMNF-MNDPQUGUSA-N |
| XLogP | 2.92 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.31 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (17Z)-17-methoxyimino-15,16-dihydrocyclopenta[a]phenanthrene-3,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (17Z)-17-methoxyimino-15,16-dihydrocyclopenta[a]phenanthrene-3,4-dione?
The IUPAC name of (17Z)-17-methoxyimino-15,16-dihydrocyclopenta[a]phenanthrene-3,4-dione (CID 6506538) is (17Z)-17-methoxyimino-15,16-dihydrocyclopenta[a]phenanthrene-3,4-dione.
What is the SMILES notation for (17Z)-17-methoxyimino-15,16-dihydrocyclopenta[a]phenanthrene-3,4-dione?
The canonical SMILES for (17Z)-17-methoxyimino-15,16-dihydrocyclopenta[a]phenanthrene-3,4-dione is CO/N=C1/CCc2c1ccc1c3c(ccc21)C(=O)C(=O)C=C3.
What is the InChIKey of (17Z)-17-methoxyimino-15,16-dihydrocyclopenta[a]phenanthrene-3,4-dione?
The InChIKey is ZTRJELYBPMBMNF-MNDPQUGUSA-N. The full InChI is InChI=1S/C18H13NO3/c1-22-19-16-8-6-12-10-3-5-15-13(7-9-17(20)18(15)21)11(10)2-4-14(12)16/h2-5,7,9H,6,8H2,1H3/b19-16-.
What are the key properties of (17Z)-17-methoxyimino-15,16-dihydrocyclopenta[a]phenanthrene-3,4-dione?
(17Z)-17-methoxyimino-15,16-dihydrocyclopenta[a]phenanthrene-3,4-dione has a molecular weight of 291.31 g/mol, XLogP of 2.92, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (17Z)-17-methoxyimino-15,16-dihydrocyclopenta[a]phenanthrene-3,4-dione is sourced from PubChem (CID 6506538), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).