C12H13F2NO5 — CID 65065686
2-[carboxymethyl-[[4-(difluoromethoxy)phenyl]methyl]amino]acetic acid (PubChem CID 65065686) has the molecular formula C12H13F2NO5 and a molecular weight of 289.23 g/mol. Its IUPAC name is 2-[carboxymethyl-[[4-(difluoromethoxy)phenyl]methyl]amino]acetic acid.
| Compound Name | 2-[carboxymethyl-[[4-(difluoromethoxy)phenyl]methyl]amino]acetic acid |
|---|---|
| PubChem CID | 65065686 |
| Molecular Formula | C12H13F2NO5 |
| Molecular Weight | 289.23 g/mol |
| Exact Mass | 289.08 |
| IUPAC Name | 2-[carboxymethyl-[[4-(difluoromethoxy)phenyl]methyl]amino]acetic acid |
| SMILES | O=C(O)CN(CC(=O)O)Cc1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C12H13F2NO5/c13-12(14)20-9-3-1-8(2-4-9)5-15(6-10(16)17)7-11(18)19/h1-4,12H,5-7H2,(H,16,17)(H,18,19) |
| InChIKey | FXIDUQUNWIBNFZ-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.23 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |