C11H21NO4 — CID 65065837
2-[carboxymethyl(heptan-3-yl)amino]acetic acid (PubChem CID 65065837) has the molecular formula C11H21NO4 and a molecular weight of 231.29 g/mol. Its IUPAC name is 2-[carboxymethyl(heptan-3-yl)amino]acetic acid.
| Compound Name | 2-[carboxymethyl(heptan-3-yl)amino]acetic acid |
|---|---|
| PubChem CID | 65065837 |
| Molecular Formula | C11H21NO4 |
| Molecular Weight | 231.29 g/mol |
| Exact Mass | 231.15 |
| IUPAC Name | 2-[carboxymethyl(heptan-3-yl)amino]acetic acid |
| SMILES | CCCCC(CC)N(CC(=O)O)CC(=O)O |
| InChI | InChI=1S/C11H21NO4/c1-3-5-6-9(4-2)12(7-10(13)14)8-11(15)16/h9H,3-8H2,1-2H3,(H,13,14)(H,15,16) |
| InChIKey | SBDYQYMUJSSBGY-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.29 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |