About 2-(1-cyclopropylethyl)-3,4-dihydro-1H-isoquinoline-1-carboxylic acid
2-(1-cyclopropylethyl)-3,4-dihydro-1H-isoquinoline-1-carboxylic acid (PubChem CID 65067131) has the molecular formula C15H19NO2
and a molecular weight of 245.32 g/mol. Its IUPAC name is 2-(1-cyclopropylethyl)-3,4-dihydro-1H-isoquinoline-1-carboxylic acid.
Molecular Properties
| Compound Name | 2-(1-cyclopropylethyl)-3,4-dihydro-1H-isoquinoline-1-carboxylic acid |
| PubChem CID | 65067131 |
| Molecular Formula | C15H19NO2 |
| Molecular Weight | 245.32 g/mol |
| Exact Mass | 245.14 |
| IUPAC Name | 2-(1-cyclopropylethyl)-3,4-dihydro-1H-isoquinoline-1-carboxylic acid |
| SMILES | CC(C1CC1)N1CCc2ccccc2C1C(=O)O |
| InChI | InChI=1S/C15H19NO2/c1-10(11-6-7-11)16-9-8-12-4-2-3-5-13(12)14(16)15(17)18/h2-5,10-11,14H,6-9H2,1H3,(H,17,18) |
| InChIKey | BRVTZCORTKXCRY-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.32 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(1-cyclopropylethyl)-3,4-dihydro-1H-isoquinoline-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1-cyclopropylethyl)-3,4-dihydro-1H-isoquinoline-1-carboxylic acid?
The IUPAC name of 2-(1-cyclopropylethyl)-3,4-dihydro-1H-isoquinoline-1-carboxylic acid (CID 65067131) is 2-(1-cyclopropylethyl)-3,4-dihydro-1H-isoquinoline-1-carboxylic acid.
What is the SMILES notation for 2-(1-cyclopropylethyl)-3,4-dihydro-1H-isoquinoline-1-carboxylic acid?
The canonical SMILES for 2-(1-cyclopropylethyl)-3,4-dihydro-1H-isoquinoline-1-carboxylic acid is CC(C1CC1)N1CCc2ccccc2C1C(=O)O.
What is the InChIKey of 2-(1-cyclopropylethyl)-3,4-dihydro-1H-isoquinoline-1-carboxylic acid?
The InChIKey is BRVTZCORTKXCRY-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H19NO2/c1-10(11-6-7-11)16-9-8-12-4-2-3-5-13(12)14(16)15(17)18/h2-5,10-11,14H,6-9H2,1H3,(H,17,18).
What are the key properties of 2-(1-cyclopropylethyl)-3,4-dihydro-1H-isoquinoline-1-carboxylic acid?
2-(1-cyclopropylethyl)-3,4-dihydro-1H-isoquinoline-1-carboxylic acid has a molecular weight of 245.32 g/mol, XLogP of 2.47, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1-cyclopropylethyl)-3,4-dihydro-1H-isoquinoline-1-carboxylic acid is sourced from PubChem (CID 65067131), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).