C12H17NO4 — CID 65067189
3-[(2,4-dihydroxyphenyl)methyl-methylamino]-2-methylpropanoic acid (PubChem CID 65067189) has the molecular formula C12H17NO4 and a molecular weight of 239.27 g/mol. Its IUPAC name is 3-[(2,4-dihydroxyphenyl)methyl-methylamino]-2-methylpropanoic acid.
| Compound Name | 3-[(2,4-dihydroxyphenyl)methyl-methylamino]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 65067189 |
| Molecular Formula | C12H17NO4 |
| Molecular Weight | 239.27 g/mol |
| Exact Mass | 239.12 |
| IUPAC Name | 3-[(2,4-dihydroxyphenyl)methyl-methylamino]-2-methylpropanoic acid |
| SMILES | CC(CN(C)Cc1ccc(O)cc1O)C(=O)O |
| InChI | InChI=1S/C12H17NO4/c1-8(12(16)17)6-13(2)7-9-3-4-10(14)5-11(9)15/h3-5,8,14-15H,6-7H2,1-2H3,(H,16,17) |
| InChIKey | GPMJCVYXCDQLRX-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 81.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.27 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|