C13H25NO2 — CID 65068571
3-methyl-1-(2-methylpentan-3-yl)piperidine-3-carboxylic acid (PubChem CID 65068571) has the molecular formula C13H25NO2 and a molecular weight of 227.35 g/mol. Its IUPAC name is 3-methyl-1-(2-methylpentan-3-yl)piperidine-3-carboxylic acid.
| Compound Name | 3-methyl-1-(2-methylpentan-3-yl)piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 65068571 |
| Molecular Formula | C13H25NO2 |
| Molecular Weight | 227.35 g/mol |
| Exact Mass | 227.19 |
| IUPAC Name | 3-methyl-1-(2-methylpentan-3-yl)piperidine-3-carboxylic acid |
| SMILES | CCC(C(C)C)N1CCCC(C)(C(=O)O)C1 |
| InChI | InChI=1S/C13H25NO2/c1-5-11(10(2)3)14-8-6-7-13(4,9-14)12(15)16/h10-11H,5-9H2,1-4H3,(H,15,16) |
| InChIKey | MBRBJJJTROJPOO-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.35 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |