C15H21NO4 — CID 65068577
1-[1-(2,4-dihydroxyphenyl)ethyl]-3-methylpiperidine-3-carboxylic acid (PubChem CID 65068577) has the molecular formula C15H21NO4 and a molecular weight of 279.34 g/mol. Its IUPAC name is 1-[1-(2,4-dihydroxyphenyl)ethyl]-3-methylpiperidine-3-carboxylic acid.
| Compound Name | 1-[1-(2,4-dihydroxyphenyl)ethyl]-3-methylpiperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 65068577 |
| Molecular Formula | C15H21NO4 |
| Molecular Weight | 279.34 g/mol |
| Exact Mass | 279.15 |
| IUPAC Name | 1-[1-(2,4-dihydroxyphenyl)ethyl]-3-methylpiperidine-3-carboxylic acid |
| SMILES | CC(c1ccc(O)cc1O)N1CCCC(C)(C(=O)O)C1 |
| InChI | InChI=1S/C15H21NO4/c1-10(12-5-4-11(17)8-13(12)18)16-7-3-6-15(2,9-16)14(19)20/h4-5,8,10,17-18H,3,6-7,9H2,1-2H3,(H,19,20) |
| InChIKey | FHLCAGWDJWBBFH-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 81.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.34 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|