C15H23NO3 — CID 65068786
1-[1-(furan-2-yl)ethyl]-3-propylpiperidine-3-carboxylic acid (PubChem CID 65068786) has the molecular formula C15H23NO3 and a molecular weight of 265.35 g/mol. Its IUPAC name is 1-[1-(furan-2-yl)ethyl]-3-propylpiperidine-3-carboxylic acid.
| Compound Name | 1-[1-(furan-2-yl)ethyl]-3-propylpiperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 65068786 |
| Molecular Formula | C15H23NO3 |
| Molecular Weight | 265.35 g/mol |
| Exact Mass | 265.17 |
| IUPAC Name | 1-[1-(furan-2-yl)ethyl]-3-propylpiperidine-3-carboxylic acid |
| SMILES | CCCC1(C(=O)O)CCCN(C(C)c2ccco2)C1 |
| InChI | InChI=1S/C15H23NO3/c1-3-7-15(14(17)18)8-5-9-16(11-15)12(2)13-6-4-10-19-13/h4,6,10,12H,3,5,7-9,11H2,1-2H3,(H,17,18) |
| InChIKey | RJJQKRQSSGAIGW-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 53.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.35 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |