C15H24F3NO2 — CID 65069192
3-propyl-1-[4-(trifluoromethyl)cyclohexyl]pyrrolidine-3-carboxylic acid (PubChem CID 65069192) has the molecular formula C15H24F3NO2 and a molecular weight of 307.36 g/mol. Its IUPAC name is 3-propyl-1-[4-(trifluoromethyl)cyclohexyl]pyrrolidine-3-carboxylic acid.
| Compound Name | 3-propyl-1-[4-(trifluoromethyl)cyclohexyl]pyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 65069192 |
| Molecular Formula | C15H24F3NO2 |
| Molecular Weight | 307.36 g/mol |
| Exact Mass | 307.18 |
| IUPAC Name | 3-propyl-1-[4-(trifluoromethyl)cyclohexyl]pyrrolidine-3-carboxylic acid |
| SMILES | CCCC1(C(=O)O)CCN(C2CCC(C(F)(F)F)CC2)C1 |
| InChI | InChI=1S/C15H24F3NO2/c1-2-7-14(13(20)21)8-9-19(10-14)12-5-3-11(4-6-12)15(16,17)18/h11-12H,2-10H2,1H3,(H,20,21) |
| InChIKey | IFWNCUAVHBBCMQ-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.36 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |