C27H23ClN2O6 — CID 6506985
[(Z)-[(6,7-dimethoxyisoquinolin-1-yl)-(3,4-dimethoxyphenyl)methylidene]amino] 2-chlorobenzoate (PubChem CID 6506985) has the molecular formula C27H23ClN2O6 and a molecular weight of 506.94 g/mol. Its IUPAC name is [(Z)-[(6,7-dimethoxyisoquinolin-1-yl)-(3,4-dimethoxyphenyl)methylidene]amino] 2-chlorobenzoate.
| Compound Name | [(Z)-[(6,7-dimethoxyisoquinolin-1-yl)-(3,4-dimethoxyphenyl)methylidene]amino] 2-chlorobenzoate |
|---|---|
| PubChem CID | 6506985 |
| Molecular Formula | C27H23ClN2O6 |
| Molecular Weight | 506.94 g/mol |
| Exact Mass | 506.12 |
| IUPAC Name | [(Z)-[(6,7-dimethoxyisoquinolin-1-yl)-(3,4-dimethoxyphenyl)methylidene]amino] 2-chlorobenzoate |
| SMILES | COc1ccc(/C(=N/OC(=O)c2ccccc2Cl)c2nccc3cc(OC)c(OC)cc23)cc1OC |
| InChI | InChI=1S/C27H23ClN2O6/c1-32-21-10-9-17(14-22(21)33-2)25(30-36-27(31)18-7-5-6-8-20(18)28)26-19-15-24(35-4)23(34-3)13-16(19)11-12-29-26/h5-15H,1-4H3/b30-25- |
| InChIKey | GSAOHMWZFXEIMT-JVCXMKTPSA-N |
| XLogP | 5.53 |
| TPSA | 88.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.94 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|