About N-(6-bromo-2,3-dihydro-1,4-benzodioxin-7-yl)-1-methylazepan-4-amine
N-(6-bromo-2,3-dihydro-1,4-benzodioxin-7-yl)-1-methylazepan-4-amine (PubChem CID 65070164) has the molecular formula C15H21BrN2O2
and a molecular weight of 341.25 g/mol. Its IUPAC name is N-(6-bromo-2,3-dihydro-1,4-benzodioxin-7-yl)-1-methylazepan-4-amine.
Molecular Properties
| Compound Name | N-(6-bromo-2,3-dihydro-1,4-benzodioxin-7-yl)-1-methylazepan-4-amine |
| PubChem CID | 65070164 |
| Molecular Formula | C15H21BrN2O2 |
| Molecular Weight | 341.25 g/mol |
| Exact Mass | 340.08 |
| IUPAC Name | N-(6-bromo-2,3-dihydro-1,4-benzodioxin-7-yl)-1-methylazepan-4-amine |
| SMILES | CN1CCCC(Nc2cc3c(cc2Br)OCCO3)CC1 |
| InChI | InChI=1S/C15H21BrN2O2/c1-18-5-2-3-11(4-6-18)17-13-10-15-14(9-12(13)16)19-7-8-20-15/h9-11,17H,2-8H2,1H3 |
| InChIKey | LKPDKTYSVALKLN-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.25 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|
Analyze N-(6-bromo-2,3-dihydro-1,4-benzodioxin-7-yl)-1-methylazepan-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(6-bromo-2,3-dihydro-1,4-benzodioxin-7-yl)-1-methylazepan-4-amine?
The IUPAC name of N-(6-bromo-2,3-dihydro-1,4-benzodioxin-7-yl)-1-methylazepan-4-amine (CID 65070164) is N-(6-bromo-2,3-dihydro-1,4-benzodioxin-7-yl)-1-methylazepan-4-amine.
What is the SMILES notation for N-(6-bromo-2,3-dihydro-1,4-benzodioxin-7-yl)-1-methylazepan-4-amine?
The canonical SMILES for N-(6-bromo-2,3-dihydro-1,4-benzodioxin-7-yl)-1-methylazepan-4-amine is CN1CCCC(Nc2cc3c(cc2Br)OCCO3)CC1.
What is the InChIKey of N-(6-bromo-2,3-dihydro-1,4-benzodioxin-7-yl)-1-methylazepan-4-amine?
The InChIKey is LKPDKTYSVALKLN-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21BrN2O2/c1-18-5-2-3-11(4-6-18)17-13-10-15-14(9-12(13)16)19-7-8-20-15/h9-11,17H,2-8H2,1H3.
What are the key properties of N-(6-bromo-2,3-dihydro-1,4-benzodioxin-7-yl)-1-methylazepan-4-amine?
N-(6-bromo-2,3-dihydro-1,4-benzodioxin-7-yl)-1-methylazepan-4-amine has a molecular weight of 341.25 g/mol, XLogP of 3.12, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(6-bromo-2,3-dihydro-1,4-benzodioxin-7-yl)-1-methylazepan-4-amine is sourced from PubChem (CID 65070164), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).