About 9-methyl-2,9-diazaspiro[4.6]undecane-1,3-dione
9-methyl-2,9-diazaspiro[4.6]undecane-1,3-dione (PubChem CID 65071381) has the molecular formula C10H16N2O2
and a molecular weight of 196.25 g/mol. Its IUPAC name is 9-methyl-2,9-diazaspiro[4.6]undecane-1,3-dione.
Molecular Properties
| Compound Name | 9-methyl-2,9-diazaspiro[4.6]undecane-1,3-dione |
| PubChem CID | 65071381 |
| Molecular Formula | C10H16N2O2 |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.12 |
| IUPAC Name | 9-methyl-2,9-diazaspiro[4.6]undecane-1,3-dione |
| SMILES | CN1CCCC2(CC1)CC(=O)NC2=O |
| InChI | InChI=1S/C10H16N2O2/c1-12-5-2-3-10(4-6-12)7-8(13)11-9(10)14/h2-7H2,1H3,(H,11,13,14) |
| InChIKey | RXUZEYXECVZKMT-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 9-methyl-2,9-diazaspiro[4.6]undecane-1,3-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-methyl-2,9-diazaspiro[4.6]undecane-1,3-dione?
The IUPAC name of 9-methyl-2,9-diazaspiro[4.6]undecane-1,3-dione (CID 65071381) is 9-methyl-2,9-diazaspiro[4.6]undecane-1,3-dione.
What is the SMILES notation for 9-methyl-2,9-diazaspiro[4.6]undecane-1,3-dione?
The canonical SMILES for 9-methyl-2,9-diazaspiro[4.6]undecane-1,3-dione is CN1CCCC2(CC1)CC(=O)NC2=O.
What is the InChIKey of 9-methyl-2,9-diazaspiro[4.6]undecane-1,3-dione?
The InChIKey is RXUZEYXECVZKMT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16N2O2/c1-12-5-2-3-10(4-6-12)7-8(13)11-9(10)14/h2-7H2,1H3,(H,11,13,14).
What are the key properties of 9-methyl-2,9-diazaspiro[4.6]undecane-1,3-dione?
9-methyl-2,9-diazaspiro[4.6]undecane-1,3-dione has a molecular weight of 196.25 g/mol, XLogP of 0.14, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 9-methyl-2,9-diazaspiro[4.6]undecane-1,3-dione is sourced from PubChem (CID 65071381), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).