C13H26N2O2S — CID 65074346
N-(1,1-dioxothian-4-yl)-1-ethylazepan-4-amine (PubChem CID 65074346) has the molecular formula C13H26N2O2S and a molecular weight of 274.43 g/mol. Its IUPAC name is N-(1,1-dioxothian-4-yl)-1-ethylazepan-4-amine.
| Compound Name | N-(1,1-dioxothian-4-yl)-1-ethylazepan-4-amine |
|---|---|
| PubChem CID | 65074346 |
| Molecular Formula | C13H26N2O2S |
| Molecular Weight | 274.43 g/mol |
| Exact Mass | 274.17 |
| IUPAC Name | N-(1,1-dioxothian-4-yl)-1-ethylazepan-4-amine |
| SMILES | CCN1CCCC(NC2CCS(=O)(=O)CC2)CC1 |
| InChI | InChI=1S/C13H26N2O2S/c1-2-15-8-3-4-12(5-9-15)14-13-6-10-18(16,17)11-7-13/h12-14H,2-11H2,1H3 |
| InChIKey | DLYMBIUTJXBJDX-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.43 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |