About 1-methyl-4-(2,2,2-trifluoroethylamino)azepane-4-carbonitrile
1-methyl-4-(2,2,2-trifluoroethylamino)azepane-4-carbonitrile (PubChem CID 65075262) has the molecular formula C10H16F3N3
and a molecular weight of 235.25 g/mol. Its IUPAC name is 1-methyl-4-(2,2,2-trifluoroethylamino)azepane-4-carbonitrile.
Molecular Properties
| Compound Name | 1-methyl-4-(2,2,2-trifluoroethylamino)azepane-4-carbonitrile |
| PubChem CID | 65075262 |
| Molecular Formula | C10H16F3N3 |
| Molecular Weight | 235.25 g/mol |
| Exact Mass | 235.13 |
| IUPAC Name | 1-methyl-4-(2,2,2-trifluoroethylamino)azepane-4-carbonitrile |
| SMILES | CN1CCCC(C#N)(NCC(F)(F)F)CC1 |
| InChI | InChI=1S/C10H16F3N3/c1-16-5-2-3-9(7-14,4-6-16)15-8-10(11,12)13/h15H,2-6,8H2,1H3 |
| InChIKey | LEGYFLKJLMYWNJ-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 39.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.25 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-methyl-4-(2,2,2-trifluoroethylamino)azepane-4-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-4-(2,2,2-trifluoroethylamino)azepane-4-carbonitrile?
The IUPAC name of 1-methyl-4-(2,2,2-trifluoroethylamino)azepane-4-carbonitrile (CID 65075262) is 1-methyl-4-(2,2,2-trifluoroethylamino)azepane-4-carbonitrile.
What is the SMILES notation for 1-methyl-4-(2,2,2-trifluoroethylamino)azepane-4-carbonitrile?
The canonical SMILES for 1-methyl-4-(2,2,2-trifluoroethylamino)azepane-4-carbonitrile is CN1CCCC(C#N)(NCC(F)(F)F)CC1.
What is the InChIKey of 1-methyl-4-(2,2,2-trifluoroethylamino)azepane-4-carbonitrile?
The InChIKey is LEGYFLKJLMYWNJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16F3N3/c1-16-5-2-3-9(7-14,4-6-16)15-8-10(11,12)13/h15H,2-6,8H2,1H3.
What are the key properties of 1-methyl-4-(2,2,2-trifluoroethylamino)azepane-4-carbonitrile?
1-methyl-4-(2,2,2-trifluoroethylamino)azepane-4-carbonitrile has a molecular weight of 235.25 g/mol, XLogP of 1.52, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-4-(2,2,2-trifluoroethylamino)azepane-4-carbonitrile is sourced from PubChem (CID 65075262), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).