About 1-propan-2-yl-4-(2,2,2-trifluoroethylamino)azepane-4-carbonitrile
1-propan-2-yl-4-(2,2,2-trifluoroethylamino)azepane-4-carbonitrile (PubChem CID 65075947) has the molecular formula C12H20F3N3
and a molecular weight of 263.31 g/mol. Its IUPAC name is 1-propan-2-yl-4-(2,2,2-trifluoroethylamino)azepane-4-carbonitrile.
Molecular Properties
| Compound Name | 1-propan-2-yl-4-(2,2,2-trifluoroethylamino)azepane-4-carbonitrile |
| PubChem CID | 65075947 |
| Molecular Formula | C12H20F3N3 |
| Molecular Weight | 263.31 g/mol |
| Exact Mass | 263.16 |
| IUPAC Name | 1-propan-2-yl-4-(2,2,2-trifluoroethylamino)azepane-4-carbonitrile |
| SMILES | CC(C)N1CCCC(C#N)(NCC(F)(F)F)CC1 |
| InChI | InChI=1S/C12H20F3N3/c1-10(2)18-6-3-4-11(8-16,5-7-18)17-9-12(13,14)15/h10,17H,3-7,9H2,1-2H3 |
| InChIKey | NUHNFXMXWNKRFT-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 39.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.31 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-propan-2-yl-4-(2,2,2-trifluoroethylamino)azepane-4-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-propan-2-yl-4-(2,2,2-trifluoroethylamino)azepane-4-carbonitrile?
The IUPAC name of 1-propan-2-yl-4-(2,2,2-trifluoroethylamino)azepane-4-carbonitrile (CID 65075947) is 1-propan-2-yl-4-(2,2,2-trifluoroethylamino)azepane-4-carbonitrile.
What is the SMILES notation for 1-propan-2-yl-4-(2,2,2-trifluoroethylamino)azepane-4-carbonitrile?
The canonical SMILES for 1-propan-2-yl-4-(2,2,2-trifluoroethylamino)azepane-4-carbonitrile is CC(C)N1CCCC(C#N)(NCC(F)(F)F)CC1.
What is the InChIKey of 1-propan-2-yl-4-(2,2,2-trifluoroethylamino)azepane-4-carbonitrile?
The InChIKey is NUHNFXMXWNKRFT-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20F3N3/c1-10(2)18-6-3-4-11(8-16,5-7-18)17-9-12(13,14)15/h10,17H,3-7,9H2,1-2H3.
What are the key properties of 1-propan-2-yl-4-(2,2,2-trifluoroethylamino)azepane-4-carbonitrile?
1-propan-2-yl-4-(2,2,2-trifluoroethylamino)azepane-4-carbonitrile has a molecular weight of 263.31 g/mol, XLogP of 2.29, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-propan-2-yl-4-(2,2,2-trifluoroethylamino)azepane-4-carbonitrile is sourced from PubChem (CID 65075947), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).