C12H27N3 — CID 65077334
N'-methyl-N'-(1-propylazepan-4-yl)ethane-1,2-diamine (PubChem CID 65077334) has the molecular formula C12H27N3 and a molecular weight of 213.37 g/mol. Its IUPAC name is N'-methyl-N'-(1-propylazepan-4-yl)ethane-1,2-diamine.
| Compound Name | N'-methyl-N'-(1-propylazepan-4-yl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 65077334 |
| Molecular Formula | C12H27N3 |
| Molecular Weight | 213.37 g/mol |
| Exact Mass | 213.22 |
| IUPAC Name | N'-methyl-N'-(1-propylazepan-4-yl)ethane-1,2-diamine |
| SMILES | CCCN1CCCC(N(C)CCN)CC1 |
| InChI | InChI=1S/C12H27N3/c1-3-8-15-9-4-5-12(6-10-15)14(2)11-7-13/h12H,3-11,13H2,1-2H3 |
| InChIKey | QSEGWHZAMFGZCD-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.37 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |