C16H34N4 — CID 65078650
4-(aminomethyl)-1-ethyl-N-methyl-N-(1-methylpiperidin-4-yl)azepan-4-amine (PubChem CID 65078650) has the molecular formula C16H34N4 and a molecular weight of 282.48 g/mol. Its IUPAC name is 4-(aminomethyl)-1-ethyl-N-methyl-N-(1-methylpiperidin-4-yl)azepan-4-amine.
| Compound Name | 4-(aminomethyl)-1-ethyl-N-methyl-N-(1-methylpiperidin-4-yl)azepan-4-amine |
|---|---|
| PubChem CID | 65078650 |
| Molecular Formula | C16H34N4 |
| Molecular Weight | 282.48 g/mol |
| Exact Mass | 282.28 |
| IUPAC Name | 4-(aminomethyl)-1-ethyl-N-methyl-N-(1-methylpiperidin-4-yl)azepan-4-amine |
| SMILES | CCN1CCCC(CN)(N(C)C2CCN(C)CC2)CC1 |
| InChI | InChI=1S/C16H34N4/c1-4-20-10-5-8-16(14-17,9-13-20)19(3)15-6-11-18(2)12-7-15/h15H,4-14,17H2,1-3H3 |
| InChIKey | YIQPTSLKAWGXGW-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 35.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.48 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |