C15H26BrN3S — CID 65078817
4-(aminomethyl)-N-[(5-bromothiophen-3-yl)methyl]-1-ethyl-N-methylazepan-4-amine (PubChem CID 65078817) has the molecular formula C15H26BrN3S and a molecular weight of 360.37 g/mol. Its IUPAC name is 4-(aminomethyl)-N-[(5-bromothiophen-3-yl)methyl]-1-ethyl-N-methylazepan-4-amine.
| Compound Name | 4-(aminomethyl)-N-[(5-bromothiophen-3-yl)methyl]-1-ethyl-N-methylazepan-4-amine |
|---|---|
| PubChem CID | 65078817 |
| Molecular Formula | C15H26BrN3S |
| Molecular Weight | 360.37 g/mol |
| Exact Mass | 359.10 |
| IUPAC Name | 4-(aminomethyl)-N-[(5-bromothiophen-3-yl)methyl]-1-ethyl-N-methylazepan-4-amine |
| SMILES | CCN1CCCC(CN)(N(C)Cc2csc(Br)c2)CC1 |
| InChI | InChI=1S/C15H26BrN3S/c1-3-19-7-4-5-15(12-17,6-8-19)18(2)10-13-9-14(16)20-11-13/h9,11H,3-8,10,12,17H2,1-2H3 |
| InChIKey | XIYLHJYTBWYPBM-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.37 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |