C11H18F3NO3 — CID 65079351
ethyl 4-(2,2,2-trifluoroethylamino)oxepane-4-carboxylate (PubChem CID 65079351) has the molecular formula C11H18F3NO3 and a molecular weight of 269.26 g/mol. Its IUPAC name is ethyl 4-(2,2,2-trifluoroethylamino)oxepane-4-carboxylate.
| Compound Name | ethyl 4-(2,2,2-trifluoroethylamino)oxepane-4-carboxylate |
|---|---|
| PubChem CID | 65079351 |
| Molecular Formula | C11H18F3NO3 |
| Molecular Weight | 269.26 g/mol |
| Exact Mass | 269.12 |
| IUPAC Name | ethyl 4-(2,2,2-trifluoroethylamino)oxepane-4-carboxylate |
| SMILES | CCOC(=O)C1(NCC(F)(F)F)CCCOCC1 |
| InChI | InChI=1S/C11H18F3NO3/c1-2-18-9(16)10(15-8-11(12,13)14)4-3-6-17-7-5-10/h15H,2-8H2,1H3 |
| InChIKey | JUMAMXHOYYEKGH-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.26 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |