C16H27N3O3 — CID 6508032
4-[2-[(2Z)-3,5-dimethyl-2-(methylhydrazinylidene)cyclohexyl]-2-hydroxyethyl]piperidine-2,6-dione (PubChem CID 6508032) has the molecular formula C16H27N3O3 and a molecular weight of 309.41 g/mol. Its IUPAC name is 4-[2-[(2Z)-3,5-dimethyl-2-(methylhydrazinylidene)cyclohexyl]-2-hydroxyethyl]piperidine-2,6-dione.
| Compound Name | 4-[2-[(2Z)-3,5-dimethyl-2-(methylhydrazinylidene)cyclohexyl]-2-hydroxyethyl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 6508032 |
| Molecular Formula | C16H27N3O3 |
| Molecular Weight | 309.41 g/mol |
| Exact Mass | 309.21 |
| IUPAC Name | 4-[2-[(2Z)-3,5-dimethyl-2-(methylhydrazinylidene)cyclohexyl]-2-hydroxyethyl]piperidine-2,6-dione |
| SMILES | CN/N=C1/C(C)CC(C)CC1C(O)CC1CC(=O)NC(=O)C1 |
| InChI | InChI=1S/C16H27N3O3/c1-9-4-10(2)16(19-17-3)12(5-9)13(20)6-11-7-14(21)18-15(22)8-11/h9-13,17,20H,4-8H2,1-3H3,(H,18,21,22)/b19-16- |
| InChIKey | IPVSENAFJSIGCV-MNDPQUGUSA-N |
| XLogP | 1.05 |
| TPSA | 90.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.41 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|