About 2-(5-phenyl-1,3,4-oxadiazol-2-yl)benzo[f]chromen-3-one
2-(5-phenyl-1,3,4-oxadiazol-2-yl)benzo[f]chromen-3-one (PubChem CID 650811) has the molecular formula C21H12N2O3
and a molecular weight of 340.34 g/mol. Its IUPAC name is 2-(5-phenyl-1,3,4-oxadiazol-2-yl)benzo[f]chromen-3-one.
Molecular Properties
| Compound Name | 2-(5-phenyl-1,3,4-oxadiazol-2-yl)benzo[f]chromen-3-one |
| PubChem CID | 650811 |
| Molecular Formula | C21H12N2O3 |
| Molecular Weight | 340.34 g/mol |
| Exact Mass | 340.08 |
| IUPAC Name | 2-(5-phenyl-1,3,4-oxadiazol-2-yl)benzo[f]chromen-3-one |
| SMILES | O=c1oc2ccc3ccccc3c2cc1-c1nnc(-c2ccccc2)o1 |
| InChI | InChI=1S/C21H12N2O3/c24-21-17(20-23-22-19(26-20)14-7-2-1-3-8-14)12-16-15-9-5-4-6-13(15)10-11-18(16)25-21/h1-12H |
| InChIKey | VIUMSGOHJAGSFZ-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 69.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.34 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 2-(5-phenyl-1,3,4-oxadiazol-2-yl)benzo[f]chromen-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(5-phenyl-1,3,4-oxadiazol-2-yl)benzo[f]chromen-3-one?
The IUPAC name of 2-(5-phenyl-1,3,4-oxadiazol-2-yl)benzo[f]chromen-3-one (CID 650811) is 2-(5-phenyl-1,3,4-oxadiazol-2-yl)benzo[f]chromen-3-one.
What is the SMILES notation for 2-(5-phenyl-1,3,4-oxadiazol-2-yl)benzo[f]chromen-3-one?
The canonical SMILES for 2-(5-phenyl-1,3,4-oxadiazol-2-yl)benzo[f]chromen-3-one is O=c1oc2ccc3ccccc3c2cc1-c1nnc(-c2ccccc2)o1.
What is the InChIKey of 2-(5-phenyl-1,3,4-oxadiazol-2-yl)benzo[f]chromen-3-one?
The InChIKey is VIUMSGOHJAGSFZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H12N2O3/c24-21-17(20-23-22-19(26-20)14-7-2-1-3-8-14)12-16-15-9-5-4-6-13(15)10-11-18(16)25-21/h1-12H.
What are the key properties of 2-(5-phenyl-1,3,4-oxadiazol-2-yl)benzo[f]chromen-3-one?
2-(5-phenyl-1,3,4-oxadiazol-2-yl)benzo[f]chromen-3-one has a molecular weight of 340.34 g/mol, XLogP of 4.66, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(5-phenyl-1,3,4-oxadiazol-2-yl)benzo[f]chromen-3-one is sourced from PubChem (CID 650811), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).