C22H26ClN3O2 — CID 6508173
ethyl (2Z)-2-(4-benzylpiperidin-1-yl)-2-[(2-chlorophenyl)hydrazinylidene]acetate (PubChem CID 6508173) has the molecular formula C22H26ClN3O2 and a molecular weight of 399.92 g/mol. Its IUPAC name is ethyl (2Z)-2-(4-benzylpiperidin-1-yl)-2-[(2-chlorophenyl)hydrazinylidene]acetate.
| Compound Name | ethyl (2Z)-2-(4-benzylpiperidin-1-yl)-2-[(2-chlorophenyl)hydrazinylidene]acetate |
|---|---|
| PubChem CID | 6508173 |
| Molecular Formula | C22H26ClN3O2 |
| Molecular Weight | 399.92 g/mol |
| Exact Mass | 399.17 |
| IUPAC Name | ethyl (2Z)-2-(4-benzylpiperidin-1-yl)-2-[(2-chlorophenyl)hydrazinylidene]acetate |
| SMILES | CCOC(=O)/C(=N/Nc1ccccc1Cl)N1CCC(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C22H26ClN3O2/c1-2-28-22(27)21(25-24-20-11-7-6-10-19(20)23)26-14-12-18(13-15-26)16-17-8-4-3-5-9-17/h3-11,18,24H,2,12-16H2,1H3/b25-21- |
| InChIKey | OBGLFWMBGKGUOH-DAFNUICNSA-N |
| XLogP | 4.58 |
| TPSA | 53.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.92 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|