C13H23N9 — CID 650820
4-N-tert-butyl-2-N,6-N-diethyl-2-N-(1,2,4-triazol-4-yl)-1,3,5-triazine-2,4,6-triamine (PubChem CID 650820) has the molecular formula C13H23N9 and a molecular weight of 305.39 g/mol. Its IUPAC name is 4-N-tert-butyl-2-N,6-N-diethyl-2-N-(1,2,4-triazol-4-yl)-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 4-N-tert-butyl-2-N,6-N-diethyl-2-N-(1,2,4-triazol-4-yl)-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 650820 |
| Molecular Formula | C13H23N9 |
| Molecular Weight | 305.39 g/mol |
| Exact Mass | 305.21 |
| IUPAC Name | 4-N-tert-butyl-2-N,6-N-diethyl-2-N-(1,2,4-triazol-4-yl)-1,3,5-triazine-2,4,6-triamine |
| SMILES | CCNc1nc(NC(C)(C)C)nc(N(CC)n2cnnc2)n1 |
| InChI | InChI=1S/C13H23N9/c1-6-14-10-17-11(20-13(3,4)5)19-12(18-10)22(7-2)21-8-15-16-9-21/h8-9H,6-7H2,1-5H3,(H2,14,17,18,19,20) |
| InChIKey | IVICYBOWSBXURO-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 96.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.39 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |