C13H20N2O — CID 65082158
N-(2-pyridin-3-ylethyl)oxepan-4-amine (PubChem CID 65082158) has the molecular formula C13H20N2O and a molecular weight of 220.32 g/mol. Its IUPAC name is N-(2-pyridin-3-ylethyl)oxepan-4-amine.
| Compound Name | N-(2-pyridin-3-ylethyl)oxepan-4-amine |
|---|---|
| PubChem CID | 65082158 |
| Molecular Formula | C13H20N2O |
| Molecular Weight | 220.32 g/mol |
| Exact Mass | 220.16 |
| IUPAC Name | N-(2-pyridin-3-ylethyl)oxepan-4-amine |
| SMILES | c1cncc(CCNC2CCCOCC2)c1 |
| InChI | InChI=1S/C13H20N2O/c1-3-12(11-14-7-1)5-8-15-13-4-2-9-16-10-6-13/h1,3,7,11,13,15H,2,4-6,8-10H2 |
| InChIKey | WYKZHAUHLRIMPH-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.32 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |