C16H29N — CID 65082973
N-(dicyclopropylmethyl)-4,4-dimethylcycloheptan-1-amine (PubChem CID 65082973) has the molecular formula C16H29N and a molecular weight of 235.41 g/mol. Its IUPAC name is N-(dicyclopropylmethyl)-4,4-dimethylcycloheptan-1-amine.
| Compound Name | N-(dicyclopropylmethyl)-4,4-dimethylcycloheptan-1-amine |
|---|---|
| PubChem CID | 65082973 |
| Molecular Formula | C16H29N |
| Molecular Weight | 235.41 g/mol |
| Exact Mass | 235.23 |
| IUPAC Name | N-(dicyclopropylmethyl)-4,4-dimethylcycloheptan-1-amine |
| SMILES | CC1(C)CCCC(NC(C2CC2)C2CC2)CC1 |
| InChI | InChI=1S/C16H29N/c1-16(2)10-3-4-14(9-11-16)17-15(12-5-6-12)13-7-8-13/h12-15,17H,3-11H2,1-2H3 |
| InChIKey | VHBOZUKCLJGWBG-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.41 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |