About N-(4,4-dimethylcycloheptyl)-8-methylquinolin-5-amine
N-(4,4-dimethylcycloheptyl)-8-methylquinolin-5-amine (PubChem CID 65083328) has the molecular formula C19H26N2
and a molecular weight of 282.43 g/mol. Its IUPAC name is N-(4,4-dimethylcycloheptyl)-8-methylquinolin-5-amine.
Molecular Properties
| Compound Name | N-(4,4-dimethylcycloheptyl)-8-methylquinolin-5-amine |
| PubChem CID | 65083328 |
| Molecular Formula | C19H26N2 |
| Molecular Weight | 282.43 g/mol |
| Exact Mass | 282.21 |
| IUPAC Name | N-(4,4-dimethylcycloheptyl)-8-methylquinolin-5-amine |
| SMILES | Cc1ccc(NC2CCCC(C)(C)CC2)c2cccnc12 |
| InChI | InChI=1S/C19H26N2/c1-14-8-9-17(16-7-5-13-20-18(14)16)21-15-6-4-11-19(2,3)12-10-15/h5,7-9,13,15,21H,4,6,10-12H2,1-3H3 |
| InChIKey | CELSEZJZNZBAEX-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 282.43 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-(4,4-dimethylcycloheptyl)-8-methylquinolin-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4,4-dimethylcycloheptyl)-8-methylquinolin-5-amine?
The IUPAC name of N-(4,4-dimethylcycloheptyl)-8-methylquinolin-5-amine (CID 65083328) is N-(4,4-dimethylcycloheptyl)-8-methylquinolin-5-amine.
What is the SMILES notation for N-(4,4-dimethylcycloheptyl)-8-methylquinolin-5-amine?
The canonical SMILES for N-(4,4-dimethylcycloheptyl)-8-methylquinolin-5-amine is Cc1ccc(NC2CCCC(C)(C)CC2)c2cccnc12.
What is the InChIKey of N-(4,4-dimethylcycloheptyl)-8-methylquinolin-5-amine?
The InChIKey is CELSEZJZNZBAEX-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H26N2/c1-14-8-9-17(16-7-5-13-20-18(14)16)21-15-6-4-11-19(2,3)12-10-15/h5,7-9,13,15,21H,4,6,10-12H2,1-3H3.
What are the key properties of N-(4,4-dimethylcycloheptyl)-8-methylquinolin-5-amine?
N-(4,4-dimethylcycloheptyl)-8-methylquinolin-5-amine has a molecular weight of 282.43 g/mol, XLogP of 5.31, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4,4-dimethylcycloheptyl)-8-methylquinolin-5-amine is sourced from PubChem (CID 65083328), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).