About 1-tert-butyl-N-(4,4-dimethylcycloheptyl)piperidin-4-amine
1-tert-butyl-N-(4,4-dimethylcycloheptyl)piperidin-4-amine (PubChem CID 65083690) has the molecular formula C18H36N2
and a molecular weight of 280.50 g/mol. Its IUPAC name is 1-tert-butyl-N-(4,4-dimethylcycloheptyl)piperidin-4-amine.
Molecular Properties
| Compound Name | 1-tert-butyl-N-(4,4-dimethylcycloheptyl)piperidin-4-amine |
| PubChem CID | 65083690 |
| Molecular Formula | C18H36N2 |
| Molecular Weight | 280.50 g/mol |
| Exact Mass | 280.29 |
| IUPAC Name | 1-tert-butyl-N-(4,4-dimethylcycloheptyl)piperidin-4-amine |
| SMILES | CC1(C)CCCC(NC2CCN(C(C)(C)C)CC2)CC1 |
| InChI | InChI=1S/C18H36N2/c1-17(2,3)20-13-9-16(10-14-20)19-15-7-6-11-18(4,5)12-8-15/h15-16,19H,6-14H2,1-5H3 |
| InChIKey | OXUUSWDIWZSMRQ-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.50 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-tert-butyl-N-(4,4-dimethylcycloheptyl)piperidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-tert-butyl-N-(4,4-dimethylcycloheptyl)piperidin-4-amine?
The IUPAC name of 1-tert-butyl-N-(4,4-dimethylcycloheptyl)piperidin-4-amine (CID 65083690) is 1-tert-butyl-N-(4,4-dimethylcycloheptyl)piperidin-4-amine.
What is the SMILES notation for 1-tert-butyl-N-(4,4-dimethylcycloheptyl)piperidin-4-amine?
The canonical SMILES for 1-tert-butyl-N-(4,4-dimethylcycloheptyl)piperidin-4-amine is CC1(C)CCCC(NC2CCN(C(C)(C)C)CC2)CC1.
What is the InChIKey of 1-tert-butyl-N-(4,4-dimethylcycloheptyl)piperidin-4-amine?
The InChIKey is OXUUSWDIWZSMRQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H36N2/c1-17(2,3)20-13-9-16(10-14-20)19-15-7-6-11-18(4,5)12-8-15/h15-16,19H,6-14H2,1-5H3.
What are the key properties of 1-tert-butyl-N-(4,4-dimethylcycloheptyl)piperidin-4-amine?
1-tert-butyl-N-(4,4-dimethylcycloheptyl)piperidin-4-amine has a molecular weight of 280.50 g/mol, XLogP of 4.20, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-tert-butyl-N-(4,4-dimethylcycloheptyl)piperidin-4-amine is sourced from PubChem (CID 65083690), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).