C17H23ClN2O — CID 65084091
6-chloro-5-[(4,4-dimethylcycloheptyl)amino]-1,3-dihydroindol-2-one (PubChem CID 65084091) has the molecular formula C17H23ClN2O and a molecular weight of 306.84 g/mol. Its IUPAC name is 6-chloro-5-[(4,4-dimethylcycloheptyl)amino]-1,3-dihydroindol-2-one.
| Compound Name | 6-chloro-5-[(4,4-dimethylcycloheptyl)amino]-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 65084091 |
| Molecular Formula | C17H23ClN2O |
| Molecular Weight | 306.84 g/mol |
| Exact Mass | 306.15 |
| IUPAC Name | 6-chloro-5-[(4,4-dimethylcycloheptyl)amino]-1,3-dihydroindol-2-one |
| SMILES | CC1(C)CCCC(Nc2cc3c(cc2Cl)NC(=O)C3)CC1 |
| InChI | InChI=1S/C17H23ClN2O/c1-17(2)6-3-4-12(5-7-17)19-15-8-11-9-16(21)20-14(11)10-13(15)18/h8,10,12,19H,3-7,9H2,1-2H3,(H,20,21) |
| InChIKey | AGWSIXYPZJZDOU-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.84 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |