C15H21Cl2N — CID 65084168
1-(2,5-dichlorophenyl)-4,4-dimethylcycloheptan-1-amine (PubChem CID 65084168) has the molecular formula C15H21Cl2N and a molecular weight of 286.25 g/mol. Its IUPAC name is 1-(2,5-dichlorophenyl)-4,4-dimethylcycloheptan-1-amine.
| Compound Name | 1-(2,5-dichlorophenyl)-4,4-dimethylcycloheptan-1-amine |
|---|---|
| PubChem CID | 65084168 |
| Molecular Formula | C15H21Cl2N |
| Molecular Weight | 286.25 g/mol |
| Exact Mass | 285.11 |
| IUPAC Name | 1-(2,5-dichlorophenyl)-4,4-dimethylcycloheptan-1-amine |
| SMILES | CC1(C)CCCC(N)(c2cc(Cl)ccc2Cl)CC1 |
| InChI | InChI=1S/C15H21Cl2N/c1-14(2)6-3-7-15(18,9-8-14)12-10-11(16)4-5-13(12)17/h4-5,10H,3,6-9,18H2,1-2H3 |
| InChIKey | MWXREFIPZOBFJS-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.25 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |