C14H28N2O2 — CID 65085158
methyl 1-[2-(dimethylamino)ethylamino]-4-methylcycloheptane-1-carboxylate (PubChem CID 65085158) has the molecular formula C14H28N2O2 and a molecular weight of 256.39 g/mol. Its IUPAC name is methyl 1-[2-(dimethylamino)ethylamino]-4-methylcycloheptane-1-carboxylate.
| Compound Name | methyl 1-[2-(dimethylamino)ethylamino]-4-methylcycloheptane-1-carboxylate |
|---|---|
| PubChem CID | 65085158 |
| Molecular Formula | C14H28N2O2 |
| Molecular Weight | 256.39 g/mol |
| Exact Mass | 256.22 |
| IUPAC Name | methyl 1-[2-(dimethylamino)ethylamino]-4-methylcycloheptane-1-carboxylate |
| SMILES | COC(=O)C1(NCCN(C)C)CCCC(C)CC1 |
| InChI | InChI=1S/C14H28N2O2/c1-12-6-5-8-14(9-7-12,13(17)18-4)15-10-11-16(2)3/h12,15H,5-11H2,1-4H3 |
| InChIKey | MYSNQDLLNCGKDL-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.39 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |