C15H19F3O — CID 65085438
4,4-dimethyl-1-(2,3,4-trifluorophenyl)cycloheptan-1-ol (PubChem CID 65085438) has the molecular formula C15H19F3O and a molecular weight of 272.31 g/mol. Its IUPAC name is 4,4-dimethyl-1-(2,3,4-trifluorophenyl)cycloheptan-1-ol.
| Compound Name | 4,4-dimethyl-1-(2,3,4-trifluorophenyl)cycloheptan-1-ol |
|---|---|
| PubChem CID | 65085438 |
| Molecular Formula | C15H19F3O |
| Molecular Weight | 272.31 g/mol |
| Exact Mass | 272.14 |
| IUPAC Name | 4,4-dimethyl-1-(2,3,4-trifluorophenyl)cycloheptan-1-ol |
| SMILES | CC1(C)CCCC(O)(c2ccc(F)c(F)c2F)CC1 |
| InChI | InChI=1S/C15H19F3O/c1-14(2)6-3-7-15(19,9-8-14)10-4-5-11(16)13(18)12(10)17/h4-5,19H,3,6-9H2,1-2H3 |
| InChIKey | NNZSVIAUTBASGE-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.31 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|