C13H23NO3 — CID 65085716
1-[ethyl(formyl)amino]-4,4-dimethylcycloheptane-1-carboxylic acid (PubChem CID 65085716) has the molecular formula C13H23NO3 and a molecular weight of 241.33 g/mol. Its IUPAC name is 1-[ethyl(formyl)amino]-4,4-dimethylcycloheptane-1-carboxylic acid.
| Compound Name | 1-[ethyl(formyl)amino]-4,4-dimethylcycloheptane-1-carboxylic acid |
|---|---|
| PubChem CID | 65085716 |
| Molecular Formula | C13H23NO3 |
| Molecular Weight | 241.33 g/mol |
| Exact Mass | 241.17 |
| IUPAC Name | 1-[ethyl(formyl)amino]-4,4-dimethylcycloheptane-1-carboxylic acid |
| SMILES | CCN(C=O)C1(C(=O)O)CCCC(C)(C)CC1 |
| InChI | InChI=1S/C13H23NO3/c1-4-14(10-15)13(11(16)17)7-5-6-12(2,3)8-9-13/h10H,4-9H2,1-3H3,(H,16,17) |
| InChIKey | CYDOXZFECMBRRI-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.33 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|