About FM1-43
FM1-43 (PubChem CID 6508724) has the molecular formula C30H49Br2N3
and a molecular weight of 611.50 g/mol. Its IUPAC name is 3-[4-[(E)-2-[4-(dibutylamino)phenyl]ethenyl]pyridin-1-ium-1-yl]propyl-triethylazanium dibromide.
Molecular Properties
| Compound Name | FM1-43 |
| PubChem CID | 6508724 |
| Molecular Formula | C30H49Br2N3 |
| Molecular Weight | 611.50 g/mol |
| Exact Mass | 611.23 |
| IUPAC Name | 3-[4-[(E)-2-[4-(dibutylamino)phenyl]ethenyl]pyridin-1-ium-1-yl]propyl-triethylazanium dibromide |
| SMILES | CCCCN(CCCC)C1=CC=C(C=C1)/C=C/C2=CC=[N+](C=C2)CCC[N+](CC)(CC)CC.[Br-].[Br-] |
| InChI | InChI=1S/C30H49N3.2BrH/c1-6-11-23-32(24-12-7-2)30-18-16-28(17-19-30)14-15-29-20-25-31(26-21-29)22-13-27-33(8-3,9-4)10-5;;/h14-21,25-26H,6-13,22-24,27H2,1-5H3;2*1H/q+2;;/p-2 |
| InChIKey | VZUVCAGXYLMFEC-UHFFFAOYSA-L |
| XLogP | — |
| TPSA | 7.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 35 |
| Complexity | 480 |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 611.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze FM1-43 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of FM1-43?
The IUPAC name of FM1-43 (CID 6508724) is 3-[4-[(E)-2-[4-(dibutylamino)phenyl]ethenyl]pyridin-1-ium-1-yl]propyl-triethylazanium dibromide.
What is the SMILES notation for FM1-43?
The canonical SMILES for FM1-43 is CCCCN(CCCC)C1=CC=C(C=C1)/C=C/C2=CC=[N+](C=C2)CCC[N+](CC)(CC)CC.[Br-].[Br-].
What is the InChIKey of FM1-43?
The InChIKey is VZUVCAGXYLMFEC-UHFFFAOYSA-L. The full InChI is InChI=1S/C30H49N3.2BrH/c1-6-11-23-32(24-12-7-2)30-18-16-28(17-19-30)14-15-29-20-25-31(26-21-29)22-13-27-33(8-3,9-4)10-5;;/h14-21,25-26H,6-13,22-24,27H2,1-5H3;2*1H/q+2;;/p-2.
What are the key properties of FM1-43?
FM1-43 has a molecular weight of 611.50 g/mol, XLogP of not available, 16 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for FM1-43 is sourced from PubChem (CID 6508724), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).