C18H29NO2 — CID 65087618
N-(3,4-dimethoxyphenyl)-4-propan-2-ylcycloheptan-1-amine (PubChem CID 65087618) has the molecular formula C18H29NO2 and a molecular weight of 291.44 g/mol. Its IUPAC name is N-(3,4-dimethoxyphenyl)-4-propan-2-ylcycloheptan-1-amine.
| Compound Name | N-(3,4-dimethoxyphenyl)-4-propan-2-ylcycloheptan-1-amine |
|---|---|
| PubChem CID | 65087618 |
| Molecular Formula | C18H29NO2 |
| Molecular Weight | 291.44 g/mol |
| Exact Mass | 291.22 |
| IUPAC Name | N-(3,4-dimethoxyphenyl)-4-propan-2-ylcycloheptan-1-amine |
| SMILES | COc1ccc(NC2CCCC(C(C)C)CC2)cc1OC |
| InChI | InChI=1S/C18H29NO2/c1-13(2)14-6-5-7-15(9-8-14)19-16-10-11-17(20-3)18(12-16)21-4/h10-15,19H,5-9H2,1-4H3 |
| InChIKey | FVHNVRBNEZAZAX-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.44 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|