About N'-[1-(aminomethyl)-4-propan-2-ylcycloheptyl]-N,N-dimethyl-N'-propylethane-1,2-diamine
N'-[1-(aminomethyl)-4-propan-2-ylcycloheptyl]-N,N-dimethyl-N'-propylethane-1,2-diamine (PubChem CID 65089094) has the molecular formula C18H39N3
and a molecular weight of 297.53 g/mol. Its IUPAC name is N'-[1-(aminomethyl)-4-propan-2-ylcycloheptyl]-N,N-dimethyl-N'-propylethane-1,2-diamine.
Molecular Properties
| Compound Name | N'-[1-(aminomethyl)-4-propan-2-ylcycloheptyl]-N,N-dimethyl-N'-propylethane-1,2-diamine |
| PubChem CID | 65089094 |
| Molecular Formula | C18H39N3 |
| Molecular Weight | 297.53 g/mol |
| Exact Mass | 297.31 |
| IUPAC Name | N'-[1-(aminomethyl)-4-propan-2-ylcycloheptyl]-N,N-dimethyl-N'-propylethane-1,2-diamine |
| SMILES | CCCN(CCN(C)C)C1(CN)CCCC(C(C)C)CC1 |
| InChI | InChI=1S/C18H39N3/c1-6-12-21(14-13-20(4)5)18(15-19)10-7-8-17(9-11-18)16(2)3/h16-17H,6-15,19H2,1-5H3 |
| InChIKey | DKXFDHBQFUFZPU-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.53 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N'-[1-(aminomethyl)-4-propan-2-ylcycloheptyl]-N,N-dimethyl-N'-propylethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-[1-(aminomethyl)-4-propan-2-ylcycloheptyl]-N,N-dimethyl-N'-propylethane-1,2-diamine?
The IUPAC name of N'-[1-(aminomethyl)-4-propan-2-ylcycloheptyl]-N,N-dimethyl-N'-propylethane-1,2-diamine (CID 65089094) is N'-[1-(aminomethyl)-4-propan-2-ylcycloheptyl]-N,N-dimethyl-N'-propylethane-1,2-diamine.
What is the SMILES notation for N'-[1-(aminomethyl)-4-propan-2-ylcycloheptyl]-N,N-dimethyl-N'-propylethane-1,2-diamine?
The canonical SMILES for N'-[1-(aminomethyl)-4-propan-2-ylcycloheptyl]-N,N-dimethyl-N'-propylethane-1,2-diamine is CCCN(CCN(C)C)C1(CN)CCCC(C(C)C)CC1.
What is the InChIKey of N'-[1-(aminomethyl)-4-propan-2-ylcycloheptyl]-N,N-dimethyl-N'-propylethane-1,2-diamine?
The InChIKey is DKXFDHBQFUFZPU-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H39N3/c1-6-12-21(14-13-20(4)5)18(15-19)10-7-8-17(9-11-18)16(2)3/h16-17H,6-15,19H2,1-5H3.
What are the key properties of N'-[1-(aminomethyl)-4-propan-2-ylcycloheptyl]-N,N-dimethyl-N'-propylethane-1,2-diamine?
N'-[1-(aminomethyl)-4-propan-2-ylcycloheptyl]-N,N-dimethyl-N'-propylethane-1,2-diamine has a molecular weight of 297.53 g/mol, XLogP of 3.19, 8 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N'-[1-(aminomethyl)-4-propan-2-ylcycloheptyl]-N,N-dimethyl-N'-propylethane-1,2-diamine is sourced from PubChem (CID 65089094), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).