About N-(2-bromo-4,6-difluorophenyl)-4-tert-butylcycloheptan-1-amine
N-(2-bromo-4,6-difluorophenyl)-4-tert-butylcycloheptan-1-amine (PubChem CID 65089523) has the molecular formula C17H24BrF2N
and a molecular weight of 360.29 g/mol. Its IUPAC name is N-(2-bromo-4,6-difluorophenyl)-4-tert-butylcycloheptan-1-amine.
Molecular Properties
| Compound Name | N-(2-bromo-4,6-difluorophenyl)-4-tert-butylcycloheptan-1-amine |
| PubChem CID | 65089523 |
| Molecular Formula | C17H24BrF2N |
| Molecular Weight | 360.29 g/mol |
| Exact Mass | 359.11 |
| IUPAC Name | N-(2-bromo-4,6-difluorophenyl)-4-tert-butylcycloheptan-1-amine |
| SMILES | CC(C)(C)C1CCCC(Nc2c(F)cc(F)cc2Br)CC1 |
| InChI | InChI=1S/C17H24BrF2N/c1-17(2,3)11-5-4-6-13(8-7-11)21-16-14(18)9-12(19)10-15(16)20/h9-11,13,21H,4-8H2,1-3H3 |
| InChIKey | ASDIZUUDENDAAX-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 360.29 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-(2-bromo-4,6-difluorophenyl)-4-tert-butylcycloheptan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-bromo-4,6-difluorophenyl)-4-tert-butylcycloheptan-1-amine?
The IUPAC name of N-(2-bromo-4,6-difluorophenyl)-4-tert-butylcycloheptan-1-amine (CID 65089523) is N-(2-bromo-4,6-difluorophenyl)-4-tert-butylcycloheptan-1-amine.
What is the SMILES notation for N-(2-bromo-4,6-difluorophenyl)-4-tert-butylcycloheptan-1-amine?
The canonical SMILES for N-(2-bromo-4,6-difluorophenyl)-4-tert-butylcycloheptan-1-amine is CC(C)(C)C1CCCC(Nc2c(F)cc(F)cc2Br)CC1.
What is the InChIKey of N-(2-bromo-4,6-difluorophenyl)-4-tert-butylcycloheptan-1-amine?
The InChIKey is ASDIZUUDENDAAX-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H24BrF2N/c1-17(2,3)11-5-4-6-13(8-7-11)21-16-14(18)9-12(19)10-15(16)20/h9-11,13,21H,4-8H2,1-3H3.
What are the key properties of N-(2-bromo-4,6-difluorophenyl)-4-tert-butylcycloheptan-1-amine?
N-(2-bromo-4,6-difluorophenyl)-4-tert-butylcycloheptan-1-amine has a molecular weight of 360.29 g/mol, XLogP of 6.13, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-bromo-4,6-difluorophenyl)-4-tert-butylcycloheptan-1-amine is sourced from PubChem (CID 65089523), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).