C19H36N2 — CID 65089610
1-(aminomethyl)-4-tert-butyl-N-cyclopropyl-N-(cyclopropylmethyl)cycloheptan-1-amine (PubChem CID 65089610) has the molecular formula C19H36N2 and a molecular weight of 292.51 g/mol. Its IUPAC name is 1-(aminomethyl)-4-tert-butyl-N-cyclopropyl-N-(cyclopropylmethyl)cycloheptan-1-amine.
| Compound Name | 1-(aminomethyl)-4-tert-butyl-N-cyclopropyl-N-(cyclopropylmethyl)cycloheptan-1-amine |
|---|---|
| PubChem CID | 65089610 |
| Molecular Formula | C19H36N2 |
| Molecular Weight | 292.51 g/mol |
| Exact Mass | 292.29 |
| IUPAC Name | 1-(aminomethyl)-4-tert-butyl-N-cyclopropyl-N-(cyclopropylmethyl)cycloheptan-1-amine |
| SMILES | CC(C)(C)C1CCCC(CN)(N(CC2CC2)C2CC2)CC1 |
| InChI | InChI=1S/C19H36N2/c1-18(2,3)16-5-4-11-19(14-20,12-10-16)21(17-8-9-17)13-15-6-7-15/h15-17H,4-14,20H2,1-3H3 |
| InChIKey | MXYLCCFRMYSDIT-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.51 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |