C20H18N4O2S2 — CID 650898
2-[1-(furan-2-ylmethyl)-5-phenylimidazol-2-yl]sulfanyl-N-(5-methyl-1,3-thiazol-2-yl)acetamide (PubChem CID 650898) has the molecular formula C20H18N4O2S2 and a molecular weight of 410.52 g/mol. Its IUPAC name is 2-[1-(furan-2-ylmethyl)-5-phenylimidazol-2-yl]sulfanyl-N-(5-methyl-1,3-thiazol-2-yl)acetamide.
| Compound Name | 2-[1-(furan-2-ylmethyl)-5-phenylimidazol-2-yl]sulfanyl-N-(5-methyl-1,3-thiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 650898 |
| Molecular Formula | C20H18N4O2S2 |
| Molecular Weight | 410.52 g/mol |
| Exact Mass | 410.09 |
| IUPAC Name | 2-[1-(furan-2-ylmethyl)-5-phenylimidazol-2-yl]sulfanyl-N-(5-methyl-1,3-thiazol-2-yl)acetamide |
| SMILES | Cc1cnc(NC(=O)CSc2ncc(-c3ccccc3)n2Cc2ccco2)s1 |
| InChI | InChI=1S/C20H18N4O2S2/c1-14-10-21-19(28-14)23-18(25)13-27-20-22-11-17(15-6-3-2-4-7-15)24(20)12-16-8-5-9-26-16/h2-11H,12-13H2,1H3,(H,21,23,25) |
| InChIKey | FIPGYNWVOVQRRX-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 72.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.52 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het_thio_5_A(8)', 'substructure': 'N/A'} |
|---|