C9H14N4S2 — CID 650908
2-(diethylamino)-6,7-dihydro-[1,3]thiazolo[3,2-a][1,3,5]triazine-4-thione (PubChem CID 650908) has the molecular formula C9H14N4S2 and a molecular weight of 242.37 g/mol. Its IUPAC name is 2-(diethylamino)-6,7-dihydro-[1,3]thiazolo[3,2-a][1,3,5]triazine-4-thione.
| Compound Name | 2-(diethylamino)-6,7-dihydro-[1,3]thiazolo[3,2-a][1,3,5]triazine-4-thione |
|---|---|
| PubChem CID | 650908 |
| Molecular Formula | C9H14N4S2 |
| Molecular Weight | 242.37 g/mol |
| Exact Mass | 242.07 |
| IUPAC Name | 2-(diethylamino)-6,7-dihydro-[1,3]thiazolo[3,2-a][1,3,5]triazine-4-thione |
| SMILES | CCN(CC)c1nc2n(c(=S)n1)CCS2 |
| InChI | InChI=1S/C9H14N4S2/c1-3-12(4-2)7-10-8(14)13-5-6-15-9(13)11-7/h3-6H2,1-2H3 |
| InChIKey | LPHTZKYBDDWSNH-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.37 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|