About N-(5,6-dihydro-4H-cyclopenta[b]thiophen-2-ylmethyl)-4-propylcycloheptan-1-amine
N-(5,6-dihydro-4H-cyclopenta[b]thiophen-2-ylmethyl)-4-propylcycloheptan-1-amine (PubChem CID 65091166) has the molecular formula C18H29NS
and a molecular weight of 291.50 g/mol. Its IUPAC name is N-(5,6-dihydro-4H-cyclopenta[b]thiophen-2-ylmethyl)-4-propylcycloheptan-1-amine.
Molecular Properties
| Compound Name | N-(5,6-dihydro-4H-cyclopenta[b]thiophen-2-ylmethyl)-4-propylcycloheptan-1-amine |
| PubChem CID | 65091166 |
| Molecular Formula | C18H29NS |
| Molecular Weight | 291.50 g/mol |
| Exact Mass | 291.20 |
| IUPAC Name | N-(5,6-dihydro-4H-cyclopenta[b]thiophen-2-ylmethyl)-4-propylcycloheptan-1-amine |
| SMILES | CCCC1CCCC(NCc2cc3c(s2)CCC3)CC1 |
| InChI | InChI=1S/C18H29NS/c1-2-5-14-6-3-8-16(11-10-14)19-13-17-12-15-7-4-9-18(15)20-17/h12,14,16,19H,2-11,13H2,1H3 |
| InChIKey | HKRRHBWAYSDOFJ-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 291.50 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-(5,6-dihydro-4H-cyclopenta[b]thiophen-2-ylmethyl)-4-propylcycloheptan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(5,6-dihydro-4H-cyclopenta[b]thiophen-2-ylmethyl)-4-propylcycloheptan-1-amine?
The IUPAC name of N-(5,6-dihydro-4H-cyclopenta[b]thiophen-2-ylmethyl)-4-propylcycloheptan-1-amine (CID 65091166) is N-(5,6-dihydro-4H-cyclopenta[b]thiophen-2-ylmethyl)-4-propylcycloheptan-1-amine.
What is the SMILES notation for N-(5,6-dihydro-4H-cyclopenta[b]thiophen-2-ylmethyl)-4-propylcycloheptan-1-amine?
The canonical SMILES for N-(5,6-dihydro-4H-cyclopenta[b]thiophen-2-ylmethyl)-4-propylcycloheptan-1-amine is CCCC1CCCC(NCc2cc3c(s2)CCC3)CC1.
What is the InChIKey of N-(5,6-dihydro-4H-cyclopenta[b]thiophen-2-ylmethyl)-4-propylcycloheptan-1-amine?
The InChIKey is HKRRHBWAYSDOFJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H29NS/c1-2-5-14-6-3-8-16(11-10-14)19-13-17-12-15-7-4-9-18(15)20-17/h12,14,16,19H,2-11,13H2,1H3.
What are the key properties of N-(5,6-dihydro-4H-cyclopenta[b]thiophen-2-ylmethyl)-4-propylcycloheptan-1-amine?
N-(5,6-dihydro-4H-cyclopenta[b]thiophen-2-ylmethyl)-4-propylcycloheptan-1-amine has a molecular weight of 291.50 g/mol, XLogP of 5.08, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(5,6-dihydro-4H-cyclopenta[b]thiophen-2-ylmethyl)-4-propylcycloheptan-1-amine is sourced from PubChem (CID 65091166), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).