C11H12N2O2 — CID 6509136
(NZ)-N-[(11Z)-11-hydroxyimino-8-pentacyclo[5.4.0.02,6.03,10.05,9]undecanylidene]hydroxylamine (PubChem CID 6509136) has the molecular formula C11H12N2O2 and a molecular weight of 204.23 g/mol. Its IUPAC name is (NZ)-N-[(11Z)-11-hydroxyimino-8-pentacyclo[5.4.0.02,6.03,10.05,9]undecanylidene]hydroxylamine.
| Compound Name | (NZ)-N-[(11Z)-11-hydroxyimino-8-pentacyclo[5.4.0.02,6.03,10.05,9]undecanylidene]hydroxylamine |
|---|---|
| PubChem CID | 6509136 |
| Molecular Formula | C11H12N2O2 |
| Molecular Weight | 204.23 g/mol |
| Exact Mass | 204.09 |
| IUPAC Name | (NZ)-N-[(11Z)-11-hydroxyimino-8-pentacyclo[5.4.0.02,6.03,10.05,9]undecanylidene]hydroxylamine |
| SMILES | O/N=C1/C2C3CC4C2/C(=N/O)C2C1C3C42 |
| InChI | InChI=1S/C11H12N2O2/c14-12-10-6-2-1-3-5-4(2)8(10)9(5)11(13-15)7(3)6/h2-9,14-15H,1H2/b12-10-,13-11- |
| InChIKey | SVFZGSIUSSQSRE-MIMPSMLTSA-N |
| XLogP | 1.03 |
| TPSA | 65.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.23 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|