About N-[1-(2,6-difluorophenyl)ethyl]-4-propylcycloheptan-1-amine
N-[1-(2,6-difluorophenyl)ethyl]-4-propylcycloheptan-1-amine (PubChem CID 65091642) has the molecular formula C18H27F2N
and a molecular weight of 295.42 g/mol. Its IUPAC name is N-[1-(2,6-difluorophenyl)ethyl]-4-propylcycloheptan-1-amine.
Molecular Properties
| Compound Name | N-[1-(2,6-difluorophenyl)ethyl]-4-propylcycloheptan-1-amine |
| PubChem CID | 65091642 |
| Molecular Formula | C18H27F2N |
| Molecular Weight | 295.42 g/mol |
| Exact Mass | 295.21 |
| IUPAC Name | N-[1-(2,6-difluorophenyl)ethyl]-4-propylcycloheptan-1-amine |
| SMILES | CCCC1CCCC(NC(C)c2c(F)cccc2F)CC1 |
| InChI | InChI=1S/C18H27F2N/c1-3-6-14-7-4-8-15(12-11-14)21-13(2)18-16(19)9-5-10-17(18)20/h5,9-10,13-15,21H,3-4,6-8,11-12H2,1-2H3 |
| InChIKey | MUMMEYABIQNQKA-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 295.42 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-[1-(2,6-difluorophenyl)ethyl]-4-propylcycloheptan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[1-(2,6-difluorophenyl)ethyl]-4-propylcycloheptan-1-amine?
The IUPAC name of N-[1-(2,6-difluorophenyl)ethyl]-4-propylcycloheptan-1-amine (CID 65091642) is N-[1-(2,6-difluorophenyl)ethyl]-4-propylcycloheptan-1-amine.
What is the SMILES notation for N-[1-(2,6-difluorophenyl)ethyl]-4-propylcycloheptan-1-amine?
The canonical SMILES for N-[1-(2,6-difluorophenyl)ethyl]-4-propylcycloheptan-1-amine is CCCC1CCCC(NC(C)c2c(F)cccc2F)CC1.
What is the InChIKey of N-[1-(2,6-difluorophenyl)ethyl]-4-propylcycloheptan-1-amine?
The InChIKey is MUMMEYABIQNQKA-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H27F2N/c1-3-6-14-7-4-8-15(12-11-14)21-13(2)18-16(19)9-5-10-17(18)20/h5,9-10,13-15,21H,3-4,6-8,11-12H2,1-2H3.
What are the key properties of N-[1-(2,6-difluorophenyl)ethyl]-4-propylcycloheptan-1-amine?
N-[1-(2,6-difluorophenyl)ethyl]-4-propylcycloheptan-1-amine has a molecular weight of 295.42 g/mol, XLogP of 5.36, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-[1-(2,6-difluorophenyl)ethyl]-4-propylcycloheptan-1-amine is sourced from PubChem (CID 65091642), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).