C17H25F2N — CID 65091754
N-[(3,4-difluorophenyl)methyl]-4-propan-2-ylcycloheptan-1-amine (PubChem CID 65091754) has the molecular formula C17H25F2N and a molecular weight of 281.39 g/mol. Its IUPAC name is N-[(3,4-difluorophenyl)methyl]-4-propan-2-ylcycloheptan-1-amine.
| Compound Name | N-[(3,4-difluorophenyl)methyl]-4-propan-2-ylcycloheptan-1-amine |
|---|---|
| PubChem CID | 65091754 |
| Molecular Formula | C17H25F2N |
| Molecular Weight | 281.39 g/mol |
| Exact Mass | 281.20 |
| IUPAC Name | N-[(3,4-difluorophenyl)methyl]-4-propan-2-ylcycloheptan-1-amine |
| SMILES | CC(C)C1CCCC(NCc2ccc(F)c(F)c2)CC1 |
| InChI | InChI=1S/C17H25F2N/c1-12(2)14-4-3-5-15(8-7-14)20-11-13-6-9-16(18)17(19)10-13/h6,9-10,12,14-15,20H,3-5,7-8,11H2,1-2H3 |
| InChIKey | RPKXNDONEPDIIX-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.39 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |