C13H18N2O2S — CID 65092958
3-[3-ethylsulfonylpropyl(methyl)amino]benzonitrile (PubChem CID 65092958) has the molecular formula C13H18N2O2S and a molecular weight of 266.37 g/mol. Its IUPAC name is 3-[3-ethylsulfonylpropyl(methyl)amino]benzonitrile.
| Compound Name | 3-[3-ethylsulfonylpropyl(methyl)amino]benzonitrile |
|---|---|
| PubChem CID | 65092958 |
| Molecular Formula | C13H18N2O2S |
| Molecular Weight | 266.37 g/mol |
| Exact Mass | 266.11 |
| IUPAC Name | 3-[3-ethylsulfonylpropyl(methyl)amino]benzonitrile |
| SMILES | CCS(=O)(=O)CCCN(C)c1cccc(C#N)c1 |
| InChI | InChI=1S/C13H18N2O2S/c1-3-18(16,17)9-5-8-15(2)13-7-4-6-12(10-13)11-14/h4,6-7,10H,3,5,8-9H2,1-2H3 |
| InChIKey | YYMHQCXNLPECGU-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 61.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.37 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |