About 3-(3-ethylsulfonylpropylsulfanyl)-1H-1,2,4-triazol-5-amine
3-(3-ethylsulfonylpropylsulfanyl)-1H-1,2,4-triazol-5-amine (PubChem CID 65093395) has the molecular formula C7H14N4O2S2
and a molecular weight of 250.35 g/mol. Its IUPAC name is 3-(3-ethylsulfonylpropylsulfanyl)-1H-1,2,4-triazol-5-amine.
Molecular Properties
| Compound Name | 3-(3-ethylsulfonylpropylsulfanyl)-1H-1,2,4-triazol-5-amine |
| PubChem CID | 65093395 |
| Molecular Formula | C7H14N4O2S2 |
| Molecular Weight | 250.35 g/mol |
| Exact Mass | 250.06 |
| IUPAC Name | 3-(3-ethylsulfonylpropylsulfanyl)-1H-1,2,4-triazol-5-amine |
| SMILES | CCS(=O)(=O)CCCSc1n[nH]c(N)n1 |
| InChI | InChI=1S/C7H14N4O2S2/c1-2-15(12,13)5-3-4-14-7-9-6(8)10-11-7/h2-5H2,1H3,(H3,8,9,10,11) |
| InChIKey | SZYCXGCQMBNCRI-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 101.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.35 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-(3-ethylsulfonylpropylsulfanyl)-1H-1,2,4-triazol-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3-ethylsulfonylpropylsulfanyl)-1H-1,2,4-triazol-5-amine?
The IUPAC name of 3-(3-ethylsulfonylpropylsulfanyl)-1H-1,2,4-triazol-5-amine (CID 65093395) is 3-(3-ethylsulfonylpropylsulfanyl)-1H-1,2,4-triazol-5-amine.
What is the SMILES notation for 3-(3-ethylsulfonylpropylsulfanyl)-1H-1,2,4-triazol-5-amine?
The canonical SMILES for 3-(3-ethylsulfonylpropylsulfanyl)-1H-1,2,4-triazol-5-amine is CCS(=O)(=O)CCCSc1n[nH]c(N)n1.
What is the InChIKey of 3-(3-ethylsulfonylpropylsulfanyl)-1H-1,2,4-triazol-5-amine?
The InChIKey is SZYCXGCQMBNCRI-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14N4O2S2/c1-2-15(12,13)5-3-4-14-7-9-6(8)10-11-7/h2-5H2,1H3,(H3,8,9,10,11).
What are the key properties of 3-(3-ethylsulfonylpropylsulfanyl)-1H-1,2,4-triazol-5-amine?
3-(3-ethylsulfonylpropylsulfanyl)-1H-1,2,4-triazol-5-amine has a molecular weight of 250.35 g/mol, XLogP of 0.30, 6 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3-ethylsulfonylpropylsulfanyl)-1H-1,2,4-triazol-5-amine is sourced from PubChem (CID 65093395), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).