C14H23FN2O2S — CID 65094027
N'-(3-ethylsulfonylpropyl)-N'-(3-fluorophenyl)propane-1,3-diamine (PubChem CID 65094027) has the molecular formula C14H23FN2O2S and a molecular weight of 302.41 g/mol. Its IUPAC name is N'-(3-ethylsulfonylpropyl)-N'-(3-fluorophenyl)propane-1,3-diamine.
| Compound Name | N'-(3-ethylsulfonylpropyl)-N'-(3-fluorophenyl)propane-1,3-diamine |
|---|---|
| PubChem CID | 65094027 |
| Molecular Formula | C14H23FN2O2S |
| Molecular Weight | 302.41 g/mol |
| Exact Mass | 302.15 |
| IUPAC Name | N'-(3-ethylsulfonylpropyl)-N'-(3-fluorophenyl)propane-1,3-diamine |
| SMILES | CCS(=O)(=O)CCCN(CCCN)c1cccc(F)c1 |
| InChI | InChI=1S/C14H23FN2O2S/c1-2-20(18,19)11-5-10-17(9-4-8-16)14-7-3-6-13(15)12-14/h3,6-7,12H,2,4-5,8-11,16H2,1H3 |
| InChIKey | IRNBSRVAAMIRAX-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.41 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |