C18H29NO — CID 65094624
(1-anilino-4-tert-butylcycloheptyl)methanol (PubChem CID 65094624) has the molecular formula C18H29NO and a molecular weight of 275.44 g/mol. Its IUPAC name is (1-anilino-4-tert-butylcycloheptyl)methanol.
| Compound Name | (1-anilino-4-tert-butylcycloheptyl)methanol |
|---|---|
| PubChem CID | 65094624 |
| Molecular Formula | C18H29NO |
| Molecular Weight | 275.44 g/mol |
| Exact Mass | 275.22 |
| IUPAC Name | (1-anilino-4-tert-butylcycloheptyl)methanol |
| SMILES | CC(C)(C)C1CCCC(CO)(Nc2ccccc2)CC1 |
| InChI | InChI=1S/C18H29NO/c1-17(2,3)15-8-7-12-18(14-20,13-11-15)19-16-9-5-4-6-10-16/h4-6,9-10,15,19-20H,7-8,11-14H2,1-3H3 |
| InChIKey | OECOVHCGVQJNHM-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.44 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |