About 7-methoxyhept-1-en-4-one
7-methoxyhept-1-en-4-one (PubChem CID 65094654) has the molecular formula C8H14O2
and a molecular weight of 142.20 g/mol. Its IUPAC name is 7-methoxyhept-1-en-4-one.
Molecular Properties
| Compound Name | 7-methoxyhept-1-en-4-one |
| PubChem CID | 65094654 |
| Molecular Formula | C8H14O2 |
| Molecular Weight | 142.20 g/mol |
| Exact Mass | 142.10 |
| IUPAC Name | 7-methoxyhept-1-en-4-one |
| SMILES | C=CCC(=O)CCCOC |
| InChI | InChI=1S/C8H14O2/c1-3-5-8(9)6-4-7-10-2/h3H,1,4-7H2,2H3 |
| InChIKey | WFJLEUHLCJPRNE-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 142.20 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 7-methoxyhept-1-en-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-methoxyhept-1-en-4-one?
The IUPAC name of 7-methoxyhept-1-en-4-one (CID 65094654) is 7-methoxyhept-1-en-4-one.
What is the SMILES notation for 7-methoxyhept-1-en-4-one?
The canonical SMILES for 7-methoxyhept-1-en-4-one is C=CCC(=O)CCCOC.
What is the InChIKey of 7-methoxyhept-1-en-4-one?
The InChIKey is WFJLEUHLCJPRNE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14O2/c1-3-5-8(9)6-4-7-10-2/h3H,1,4-7H2,2H3.
What are the key properties of 7-methoxyhept-1-en-4-one?
7-methoxyhept-1-en-4-one has a molecular weight of 142.20 g/mol, XLogP of 1.56, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-methoxyhept-1-en-4-one is sourced from PubChem (CID 65094654), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).